C18H17BrClN3O2S — CID 73450398
4-(4-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine;hydrobromide (PubChem CID 73450398) has the molecular formula C18H17BrClN3O2S and a molecular weight of 454.78 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine;hydrobromide.
| Compound Name | 4-(4-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine;hydrobromide |
|---|---|
| PubChem CID | 73450398 |
| Molecular Formula | C18H17BrClN3O2S |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.COc1ccc(C=NNc2nc(-c3ccc(Cl)cc3)cs2)cc1OC |
| InChI | InChI=1S/C18H16ClN3O2S.BrH/c1-23-16-8-3-12(9-17(16)24-2)10-20-22-18-21-15(11-25-18)13-4-6-14(19)7-5-13;/h3-11H,1-2H3,(H,21,22);1H |
| InChIKey | BCXWBRRKLYLKOK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|