C15H21N4O2S+ — CID 73450466
5-butan-2-ylsulfanyl-7-cyclopropyl-1,3-dimethyl-4aH-pyrimido[4,5-d]pyrimidin-1-ium-2,4-dione (PubChem CID 73450466) has the molecular formula C15H21N4O2S+ and a molecular weight of 321.43 g/mol. Its IUPAC name is 5-butan-2-ylsulfanyl-7-cyclopropyl-1,3-dimethyl-4aH-pyrimido[4,5-d]pyrimidin-1-ium-2,4-dione.
| Compound Name | 5-butan-2-ylsulfanyl-7-cyclopropyl-1,3-dimethyl-4aH-pyrimido[4,5-d]pyrimidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 73450466 |
| Molecular Formula | C15H21N4O2S+ |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 5-butan-2-ylsulfanyl-7-cyclopropyl-1,3-dimethyl-4aH-pyrimido[4,5-d]pyrimidin-1-ium-2,4-dione |
| SMILES | CCC(C)SC1=NC(C2CC2)=NC2=[N+](C)C(=O)N(C)C(=O)C12 |
| InChI | InChI=1S/C15H21N4O2S/c1-5-8(2)22-13-10-12(16-11(17-13)9-6-7-9)18(3)15(21)19(4)14(10)20/h8-10H,5-7H2,1-4H3/q+1 |
| InChIKey | WEBLYXGGRBIKNL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|