C16H22N5O3S+ — CID 73450964
2-[(7-cyclohexyl-1,3-dimethyl-2,4-dioxo-4aH-pyrimido[4,5-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide (PubChem CID 73450964) has the molecular formula C16H22N5O3S+ and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[(7-cyclohexyl-1,3-dimethyl-2,4-dioxo-4aH-pyrimido[4,5-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide.
| Compound Name | 2-[(7-cyclohexyl-1,3-dimethyl-2,4-dioxo-4aH-pyrimido[4,5-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 73450964 |
| Molecular Formula | C16H22N5O3S+ |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[(7-cyclohexyl-1,3-dimethyl-2,4-dioxo-4aH-pyrimido[4,5-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide |
| SMILES | CN1C(=O)C2C(SCC(N)=O)=NC(C3CCCCC3)=NC2=[N+](C)C1=O |
| InChI | InChI=1S/C16H21N5O3S/c1-20-13-11(15(23)21(2)16(20)24)14(25-8-10(17)22)19-12(18-13)9-6-4-3-5-7-9/h9,11H,3-8H2,1-2H3,(H-,17,22)/p+1 |
| InChIKey | GKCJFDAJGZWDBT-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|