C25H31N5O4S — CID 73451036
N-(4-ethylphenyl)-2-[[7-(3-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide (PubChem CID 73451036) has the molecular formula C25H31N5O4S and a molecular weight of 497.62 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[[7-(3-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[[7-(3-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 73451036 |
| Molecular Formula | C25H31N5O4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-(4-ethylphenyl)-2-[[7-(3-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide |
| SMILES | CCc1ccc(NC(=O)CSC2NC(c3cccc(OC)c3)NC3C2C(=O)N(C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C25H31N5O4S/c1-5-15-9-11-17(12-10-15)26-19(31)14-35-23-20-22(29(2)25(33)30(3)24(20)32)27-21(28-23)16-7-6-8-18(13-16)34-4/h6-13,20-23,27-28H,5,14H2,1-4H3,(H,26,31) |
| InChIKey | CMVIGPFCPLGHHV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |