C26H21FN3O4+ — CID 73451125
N-[(4-fluorophenyl)methyl]-2-[3-(4-methylphenyl)-2,4-dioxo-4aH-[1]benzofuro[3,2-d]pyrimidin-1-ium-1-yl]acetamide (PubChem CID 73451125) has the molecular formula C26H21FN3O4+ and a molecular weight of 458.47 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[3-(4-methylphenyl)-2,4-dioxo-4aH-[1]benzofuro[3,2-d]pyrimidin-1-ium-1-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[3-(4-methylphenyl)-2,4-dioxo-4aH-[1]benzofuro[3,2-d]pyrimidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 73451125 |
| Molecular Formula | C26H21FN3O4+ |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[3-(4-methylphenyl)-2,4-dioxo-4aH-[1]benzofuro[3,2-d]pyrimidin-1-ium-1-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)C3Oc4ccccc4C3=[N+](CC(=O)NCc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H20FN3O4/c1-16-6-12-19(13-7-16)30-25(32)24-23(20-4-2-3-5-21(20)34-24)29(26(30)33)15-22(31)28-14-17-8-10-18(27)11-9-17/h2-13,24H,14-15H2,1H3/p+1 |
| InChIKey | VHKMKEPCEMPFSD-UHFFFAOYSA-O |
| XLogP | 3.18 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|