C21H23N3O2S2 — CID 73452225
N-(1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 73452225) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 73452225 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccs1)N(CCCN1CCOCC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H23N3O2S2/c25-20(9-8-17-5-3-16-27-17)24(11-4-10-23-12-14-26-15-13-23)21-22-18-6-1-2-7-19(18)28-21/h1-3,5-9,16H,4,10-15H2 |
| InChIKey | ZWJXJNKOLFSIHQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|