C12H16N3O2S+ — CID 73452542
6-ethyl-1,3-dimethyl-5-methylsulfanyl-4aH-pyrido[2,3-d]pyrimidin-1-ium-2,4-dione (PubChem CID 73452542) has the molecular formula C12H16N3O2S+ and a molecular weight of 266.35 g/mol. Its IUPAC name is 6-ethyl-1,3-dimethyl-5-methylsulfanyl-4aH-pyrido[2,3-d]pyrimidin-1-ium-2,4-dione.
| Compound Name | 6-ethyl-1,3-dimethyl-5-methylsulfanyl-4aH-pyrido[2,3-d]pyrimidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 73452542 |
| Molecular Formula | C12H16N3O2S+ |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 6-ethyl-1,3-dimethyl-5-methylsulfanyl-4aH-pyrido[2,3-d]pyrimidin-1-ium-2,4-dione |
| SMILES | CCC1=C(SC)C2C(=O)N(C)C(=O)[N+](C)=C2N=C1 |
| InChI | InChI=1S/C12H16N3O2S/c1-5-7-6-13-10-8(9(7)18-4)11(16)15(3)12(17)14(10)2/h6,8H,5H2,1-4H3/q+1 |
| InChIKey | CVTUTMQZJOSYAZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|