C21H26N3O4S+ — CID 73452605
5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3-dimethyl-6-propyl-4aH-pyrido[2,3-d]pyrimidin-1-ium-2,4-dione (PubChem CID 73452605) has the molecular formula C21H26N3O4S+ and a molecular weight of 416.52 g/mol. Its IUPAC name is 5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3-dimethyl-6-propyl-4aH-pyrido[2,3-d]pyrimidin-1-ium-2,4-dione.
| Compound Name | 5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3-dimethyl-6-propyl-4aH-pyrido[2,3-d]pyrimidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 73452605 |
| Molecular Formula | C21H26N3O4S+ |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3-dimethyl-6-propyl-4aH-pyrido[2,3-d]pyrimidin-1-ium-2,4-dione |
| SMILES | CCCC1=C(SCc2cc(OC)cc(OC)c2)C2C(=O)N(C)C(=O)[N+](C)=C2N=C1 |
| InChI | InChI=1S/C21H26N3O4S/c1-6-7-14-11-22-19-17(20(25)24(3)21(26)23(19)2)18(14)29-12-13-8-15(27-4)10-16(9-13)28-5/h8-11,17H,6-7,12H2,1-5H3/q+1 |
| InChIKey | AHSQKXGUBQJFFK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|