About 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione
3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione (PubChem CID 73453235) has the molecular formula C13H20N4O3S
and a molecular weight of 312.40 g/mol. Its IUPAC name is 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione |
| PubChem CID | 73453235 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione |
| SMILES | CC(=O)CSC1=NC2C(C(=O)NC(=O)N2C)N1CC(C)C |
| InChI | InChI=1S/C13H20N4O3S/c1-7(2)5-17-9-10(14-13(17)21-6-8(3)18)16(4)12(20)15-11(9)19/h7,9-10H,5-6H2,1-4H3,(H,15,19,20) |
| InChIKey | QKJQMZQYKSUVRN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione?
The IUPAC name of 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione (CID 73453235) is 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione.
What is the SMILES notation for 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione?
The canonical SMILES for 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione is CC(=O)CSC1=NC2C(C(=O)NC(=O)N2C)N1CC(C)C.
What is the InChIKey of 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione?
The InChIKey is QKJQMZQYKSUVRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O3S/c1-7(2)5-17-9-10(14-13(17)21-6-8(3)18)16(4)12(20)15-11(9)19/h7,9-10H,5-6H2,1-4H3,(H,15,19,20).
What are the key properties of 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione?
3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione has a molecular weight of 312.40 g/mol, XLogP of 0.51, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7-(2-methylpropyl)-8-(2-oxopropylsulfanyl)-4,5-dihydropurine-2,6-dione is sourced from PubChem (CID 73453235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).