C16H9N2O5- — CID 7345375
4-nitro-2-[(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenolate (PubChem CID 7345375) has the molecular formula C16H9N2O5- and a molecular weight of 309.26 g/mol. Its IUPAC name is 4-nitro-2-[(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenolate.
| Compound Name | 4-nitro-2-[(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenolate |
|---|---|
| PubChem CID | 7345375 |
| Molecular Formula | C16H9N2O5- |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 4-nitro-2-[(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenolate |
| SMILES | O=C1OC(c2ccccc2)=N/C1=C\c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C16H10N2O5/c19-14-7-6-12(18(21)22)8-11(14)9-13-16(20)23-15(17-13)10-4-2-1-3-5-10/h1-9,19H/p-1/b13-9- |
| InChIKey | QIQHRYFDXTWGFB-LCYFTJDESA-M |
| XLogP | 2.01 |
| TPSA | 104.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|