C30H18F6N2O — CID 73454080
2-[3,5-bis(trifluoromethyl)phenyl]-3-[9-(4-methoxyphenyl)carbazol-3-yl]prop-2-enenitrile (PubChem CID 73454080) has the molecular formula C30H18F6N2O and a molecular weight of 536.48 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-3-[9-(4-methoxyphenyl)carbazol-3-yl]prop-2-enenitrile.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-3-[9-(4-methoxyphenyl)carbazol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 73454080 |
| Molecular Formula | C30H18F6N2O |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-3-[9-(4-methoxyphenyl)carbazol-3-yl]prop-2-enenitrile |
| SMILES | COc1ccc(-n2c3ccccc3c3cc(C=C(C#N)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)ccc32)cc1 |
| InChI | InChI=1S/C30H18F6N2O/c1-39-24-9-7-23(8-10-24)38-27-5-3-2-4-25(27)26-13-18(6-11-28(26)38)12-20(17-37)19-14-21(29(31,32)33)16-22(15-19)30(34,35)36/h2-16H,1H3 |
| InChIKey | FIUNEJYXZXEEBW-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|