C12H21N5O — CID 73456495
2-amino-5,6,6,7,7,8-hexamethyl-4aH-pteridin-4-one (PubChem CID 73456495) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-amino-5,6,6,7,7,8-hexamethyl-4aH-pteridin-4-one.
| Compound Name | 2-amino-5,6,6,7,7,8-hexamethyl-4aH-pteridin-4-one |
|---|---|
| PubChem CID | 73456495 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-amino-5,6,6,7,7,8-hexamethyl-4aH-pteridin-4-one |
| SMILES | CN1C2=NC(N)=NC(=O)C2N(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C12H21N5O/c1-11(2)12(3,4)17(6)8-7(16(11)5)9(18)15-10(13)14-8/h7H,1-6H3,(H2,13,15,18) |
| InChIKey | HPKZCMKKBKYULB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 74.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |