C19H14F5IN4O2 — CID 73456580
N-[6-[1-(2,3-difluorophenyl)-3-(methylaminooxy)prop-1-enyl]-3-iodoimidazo[1,2-a]pyridin-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 73456580) has the molecular formula C19H14F5IN4O2 and a molecular weight of 552.24 g/mol. Its IUPAC name is N-[6-[1-(2,3-difluorophenyl)-3-(methylaminooxy)prop-1-enyl]-3-iodoimidazo[1,2-a]pyridin-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-[1-(2,3-difluorophenyl)-3-(methylaminooxy)prop-1-enyl]-3-iodoimidazo[1,2-a]pyridin-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 73456580 |
| Molecular Formula | C19H14F5IN4O2 |
| Molecular Weight | 552.24 g/mol |
| Exact Mass | 552.01 |
| IUPAC Name | N-[6-[1-(2,3-difluorophenyl)-3-(methylaminooxy)prop-1-enyl]-3-iodoimidazo[1,2-a]pyridin-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CNOCC=C(c1ccc2nc(NC(=O)C(F)(F)F)c(I)n2c1)c1cccc(F)c1F |
| InChI | InChI=1S/C19H14F5IN4O2/c1-26-31-8-7-11(12-3-2-4-13(20)15(12)21)10-5-6-14-27-17(16(25)29(14)9-10)28-18(30)19(22,23)24/h2-7,9,26H,8H2,1H3,(H,28,30) |
| InChIKey | HIPDOIUVAPWKGX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|