disodium;3-hydroxybenzoic acid

C7H6Na2O3+2 — CID 73456798

IUPACdisodium;3-hydroxybenzoic acid
SMILESO=C(O)c1cccc(O)c1.[Na+].[Na+]
InChIInChI=1S/C7H6O3.2Na/c8-6-3-1-2-5(4-6)7(9)10;;/h1-4,8H,(H,9,10);;/q;2*+1
InChIKeyKPDHGKXLISFTMT-UHFFFAOYSA-N
MW184.10 g/mol
LogP-4.90
Rot. Bonds1

About disodium;3-hydroxybenzoic acid

disodium;3-hydroxybenzoic acid (PubChem CID 73456798) has the molecular formula C7H6Na2O3+2 and a molecular weight of 184.10 g/mol. Its IUPAC name is disodium;3-hydroxybenzoic acid.

Molecular Properties

Compound Namedisodium;3-hydroxybenzoic acid
PubChem CID73456798
Molecular FormulaC7H6Na2O3+2
Molecular Weight184.10 g/mol
Exact Mass184.01
IUPAC Namedisodium;3-hydroxybenzoic acid
SMILESO=C(O)c1cccc(O)c1.[Na+].[Na+]
InChIInChI=1S/C7H6O3.2Na/c8-6-3-1-2-5(4-6)7(9)10;;/h1-4,8H,(H,9,10);;/q;2*+1
InChIKeyKPDHGKXLISFTMT-UHFFFAOYSA-N
XLogP-4.90
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.10
LogP ≤ 5-4.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze disodium;3-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of disodium;3-hydroxybenzoic acid?
The IUPAC name of disodium;3-hydroxybenzoic acid (CID 73456798) is disodium;3-hydroxybenzoic acid.
What is the SMILES notation for disodium;3-hydroxybenzoic acid?
The canonical SMILES for disodium;3-hydroxybenzoic acid is O=C(O)c1cccc(O)c1.[Na+].[Na+].
What is the InChIKey of disodium;3-hydroxybenzoic acid?
The InChIKey is KPDHGKXLISFTMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.2Na/c8-6-3-1-2-5(4-6)7(9)10;;/h1-4,8H,(H,9,10);;/q;2*+1.
What are the key properties of disodium;3-hydroxybenzoic acid?
disodium;3-hydroxybenzoic acid has a molecular weight of 184.10 g/mol, XLogP of -4.90, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3-hydroxybenzoic acid is sourced from PubChem (CID 73456798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).