About (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one
(5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one (PubChem CID 7345882) has the molecular formula C23H26N2O3
and a molecular weight of 378.47 g/mol. Its IUPAC name is (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one |
| PubChem CID | 7345882 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one |
| SMILES | COc1ccc(CCN2C(=O)CC[C@H]2c2cn(C)c3ccccc23)cc1OC |
| InChI | InChI=1S/C23H26N2O3/c1-24-15-18(17-6-4-5-7-19(17)24)20-9-11-23(26)25(20)13-12-16-8-10-21(27-2)22(14-16)28-3/h4-8,10,14-15,20H,9,11-13H2,1-3H3/t20-/m0/s1 |
| InChIKey | YWFGNGZKIQAMNI-FQEVSTJZSA-N |
| XLogP | 4.10 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one?
The IUPAC name of (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one (CID 7345882) is (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one.
What is the SMILES notation for (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one?
The canonical SMILES for (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one is COc1ccc(CCN2C(=O)CC[C@H]2c2cn(C)c3ccccc23)cc1OC.
What is the InChIKey of (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one?
The InChIKey is YWFGNGZKIQAMNI-FQEVSTJZSA-N. The full InChI is InChI=1S/C23H26N2O3/c1-24-15-18(17-6-4-5-7-19(17)24)20-9-11-23(26)25(20)13-12-16-8-10-21(27-2)22(14-16)28-3/h4-8,10,14-15,20H,9,11-13H2,1-3H3/t20-/m0/s1.
What are the key properties of (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one?
(5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one has a molecular weight of 378.47 g/mol, XLogP of 4.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-(1-methylindol-3-yl)pyrrolidin-2-one is sourced from PubChem (CID 7345882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).