C21H17BrN4O4S — CID 73460739
N'-(5-bromo-2-pyridinyl)-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enediamide (PubChem CID 73460739) has the molecular formula C21H17BrN4O4S and a molecular weight of 501.36 g/mol. Its IUPAC name is N'-(5-bromo-2-pyridinyl)-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enediamide.
| Compound Name | N'-(5-bromo-2-pyridinyl)-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enediamide |
|---|---|
| PubChem CID | 73460739 |
| Molecular Formula | C21H17BrN4O4S |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 500.02 |
| IUPAC Name | N'-(5-bromo-2-pyridinyl)-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enediamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc(NC(=O)C=CC(=O)Nc2ccc(Br)cn2)cc1 |
| InChI | InChI=1S/C21H17BrN4O4S/c22-15-7-10-19(24-13-15)26-21(28)12-11-20(27)25-16-8-5-14(6-9-16)17-3-1-2-4-18(17)31(23,29)30/h1-13H,(H,25,27)(H2,23,29,30)(H,24,26,28) |
| InChIKey | GLTIAPUEVNEYGB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|