About 1,1,2-triaminoguanidine;hydrochloride
1,1,2-triaminoguanidine;hydrochloride (PubChem CID 73462575) has the molecular formula CH9ClN6
and a molecular weight of 140.58 g/mol. Its IUPAC name is 1,1,2-triaminoguanidine;hydrochloride.
Molecular Properties
| Compound Name | 1,1,2-triaminoguanidine;hydrochloride |
| PubChem CID | 73462575 |
| Molecular Formula | CH9ClN6 |
| Molecular Weight | 140.58 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1,1,2-triaminoguanidine;hydrochloride |
| SMILES | Cl.NN=C(N)N(N)N |
| InChI | InChI=1S/CH8N6.ClH/c2-1(6-3)7(4)5;/h3-5H2,(H2,2,6);1H |
| InChIKey | VYTRGRLCKXQCED-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.58 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2-triaminoguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-triaminoguanidine;hydrochloride?
The IUPAC name of 1,1,2-triaminoguanidine;hydrochloride (CID 73462575) is 1,1,2-triaminoguanidine;hydrochloride.
What is the SMILES notation for 1,1,2-triaminoguanidine;hydrochloride?
The canonical SMILES for 1,1,2-triaminoguanidine;hydrochloride is Cl.NN=C(N)N(N)N.
What is the InChIKey of 1,1,2-triaminoguanidine;hydrochloride?
The InChIKey is VYTRGRLCKXQCED-UHFFFAOYSA-N. The full InChI is InChI=1S/CH8N6.ClH/c2-1(6-3)7(4)5;/h3-5H2,(H2,2,6);1H.
What are the key properties of 1,1,2-triaminoguanidine;hydrochloride?
1,1,2-triaminoguanidine;hydrochloride has a molecular weight of 140.58 g/mol, XLogP of -2.35, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-triaminoguanidine;hydrochloride is sourced from PubChem (CID 73462575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).