C19H20N2O3S2 — CID 73462808
propan-2-yl 2-[3-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate (PubChem CID 73462808) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is propan-2-yl 2-[3-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate.
| Compound Name | propan-2-yl 2-[3-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 73462808 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | propan-2-yl 2-[3-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate |
| SMILES | CCN1C(=O)C(=Cc2cn(CC(=O)OC(C)C)c3ccccc23)SC1=S |
| InChI | InChI=1S/C19H20N2O3S2/c1-4-21-18(23)16(26-19(21)25)9-13-10-20(11-17(22)24-12(2)3)15-8-6-5-7-14(13)15/h5-10,12H,4,11H2,1-3H3 |
| InChIKey | FUBQWCOPQNTZRQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|