C14H16BrN3S — CID 7346416
(Z)-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-3-ethyl-4-methyl-1,3-thiazol-2-imine (PubChem CID 7346416) has the molecular formula C14H16BrN3S and a molecular weight of 338.27 g/mol. Its IUPAC name is (Z)-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-3-ethyl-4-methyl-1,3-thiazol-2-imine.
| Compound Name | (Z)-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-3-ethyl-4-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 7346416 |
| Molecular Formula | C14H16BrN3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | (Z)-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-3-ethyl-4-methyl-1,3-thiazol-2-imine |
| SMILES | CCn1c(C)cs/c1=N\N=C(\C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H16BrN3S/c1-4-18-10(2)9-19-14(18)17-16-11(3)12-5-7-13(15)8-6-12/h5-9H,4H2,1-3H3/b16-11-,17-14- |
| InChIKey | GQWPANXECPGWAF-MJZIEMGNSA-N |
| XLogP | 3.97 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|