About 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione
8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione (PubChem CID 73472778) has the molecular formula C14H13N4O2+
and a molecular weight of 269.28 g/mol. Its IUPAC name is 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione.
Molecular Properties
| Compound Name | 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione |
| PubChem CID | 73472778 |
| Molecular Formula | C14H13N4O2+ |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione |
| SMILES | CN1C(=O)C2=NC(Cc3ccccc3)=NC2=[N+](C)C1=O |
| InChI | InChI=1S/C14H13N4O2/c1-17-12-11(13(19)18(2)14(17)20)15-10(16-12)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3/q+1 |
| InChIKey | OXBYCPITDWVZRO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione?
The IUPAC name of 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione (CID 73472778) is 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione.
What is the SMILES notation for 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione?
The canonical SMILES for 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione is CN1C(=O)C2=NC(Cc3ccccc3)=NC2=[N+](C)C1=O.
What is the InChIKey of 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione?
The InChIKey is OXBYCPITDWVZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N4O2/c1-17-12-11(13(19)18(2)14(17)20)15-10(16-12)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3/q+1.
What are the key properties of 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione?
8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione has a molecular weight of 269.28 g/mol, XLogP of 0.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-1,3-dimethylpurin-3-ium-2,6-dione is sourced from PubChem (CID 73472778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).