C21H21ClFN3O — CID 7347444
3-(2-chlorophenyl)-1-(4-fluorophenyl)-N-[(2R)-3-methylbutan-2-yl]pyrazole-5-carboxamide (PubChem CID 7347444) has the molecular formula C21H21ClFN3O and a molecular weight of 385.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-(4-fluorophenyl)-N-[(2R)-3-methylbutan-2-yl]pyrazole-5-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-1-(4-fluorophenyl)-N-[(2R)-3-methylbutan-2-yl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 7347444 |
| Molecular Formula | C21H21ClFN3O |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-(2-chlorophenyl)-1-(4-fluorophenyl)-N-[(2R)-3-methylbutan-2-yl]pyrazole-5-carboxamide |
| SMILES | CC(C)[C@@H](C)NC(=O)c1cc(-c2ccccc2Cl)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21ClFN3O/c1-13(2)14(3)24-21(27)20-12-19(17-6-4-5-7-18(17)22)25-26(20)16-10-8-15(23)9-11-16/h4-14H,1-3H3,(H,24,27)/t14-/m1/s1 |
| InChIKey | FOQGTEKDQTUFNS-CQSZACIVSA-N |
| XLogP | 5.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |