C18H16N2O3S — CID 7347532
ethyl (4R)-5-cyano-2-methyl-6-pyrrol-1-yl-4-thiophen-3-yl-4H-pyran-3-carboxylate (PubChem CID 7347532) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is ethyl (4R)-5-cyano-2-methyl-6-pyrrol-1-yl-4-thiophen-3-yl-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4R)-5-cyano-2-methyl-6-pyrrol-1-yl-4-thiophen-3-yl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 7347532 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | ethyl (4R)-5-cyano-2-methyl-6-pyrrol-1-yl-4-thiophen-3-yl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(n2cccc2)=C(C#N)[C@H]1c1ccsc1 |
| InChI | InChI=1S/C18H16N2O3S/c1-3-22-18(21)15-12(2)23-17(20-7-4-5-8-20)14(10-19)16(15)13-6-9-24-11-13/h4-9,11,16H,3H2,1-2H3/t16-/m1/s1 |
| InChIKey | OJMGWNRYMIEXPE-MRXNPFEDSA-N |
| XLogP | 3.89 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |