C18H14N4O5 — CID 7348154
2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-1,2,5-oxadiazol-3-yl]isoindole-1,3-dione (PubChem CID 7348154) has the molecular formula C18H14N4O5 and a molecular weight of 366.33 g/mol. Its IUPAC name is 2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-1,2,5-oxadiazol-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-1,2,5-oxadiazol-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7348154 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-1,2,5-oxadiazol-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1nonc1N1C(=O)[C@@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C18H14N4O5/c23-15-9-5-1-2-6-10(9)16(24)21(15)13-14(20-27-19-13)22-17(25)11-7-3-4-8-12(11)18(22)26/h1-2,5-6,11-12H,3-4,7-8H2/t11-,12-/m1/s1 |
| InChIKey | UZNZQPZHXRJMAL-VXGBXAGGSA-N |
| XLogP | 1.55 |
| TPSA | 113.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|