About (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole
(4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole (PubChem CID 7348293) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole.
Molecular Properties
| Compound Name | (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole |
| PubChem CID | 7348293 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole |
| SMILES | CC1(C)ON=C(c2ccccc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O3/c1-11(2)10(13(14)15)9(12-16-11)8-6-4-3-5-7-8/h3-7,10H,1-2H3/t10-/m0/s1 |
| InChIKey | QFENGDMXCZZCNK-JTQLQIEISA-N |
| XLogP | 1.84 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole?
The IUPAC name of (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole (CID 7348293) is (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole.
What is the SMILES notation for (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole?
The canonical SMILES for (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole is CC1(C)ON=C(c2ccccc2)[C@@H]1[N+](=O)[O-].
What is the InChIKey of (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole?
The InChIKey is QFENGDMXCZZCNK-JTQLQIEISA-N. The full InChI is InChI=1S/C11H12N2O3/c1-11(2)10(13(14)15)9(12-16-11)8-6-4-3-5-7-8/h3-7,10H,1-2H3/t10-/m0/s1.
What are the key properties of (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole?
(4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole has a molecular weight of 220.23 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5,5-dimethyl-4-nitro-3-phenyl-4H-1,2-oxazole is sourced from PubChem (CID 7348293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).