About 1H-2,1-benzothiazol-3-one
1H-2,1-benzothiazol-3-one (PubChem CID 734839) has the molecular formula C7H5NOS
and a molecular weight of 151.19 g/mol. Its IUPAC name is 1H-2,1-benzothiazol-3-one.
Molecular Properties
| Compound Name | 1H-2,1-benzothiazol-3-one |
| PubChem CID | 734839 |
| Molecular Formula | C7H5NOS |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.01 |
| IUPAC Name | 1H-2,1-benzothiazol-3-one |
| SMILES | O=c1s[nH]c2ccccc12 |
| InChI | InChI=1S/C7H5NOS/c9-7-5-3-1-2-4-6(5)8-10-7/h1-4,8H |
| InChIKey | DPBKQJOOSMJCFX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-2,1-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-2,1-benzothiazol-3-one?
The IUPAC name of 1H-2,1-benzothiazol-3-one (CID 734839) is 1H-2,1-benzothiazol-3-one.
What is the SMILES notation for 1H-2,1-benzothiazol-3-one?
The canonical SMILES for 1H-2,1-benzothiazol-3-one is O=c1s[nH]c2ccccc12.
What is the InChIKey of 1H-2,1-benzothiazol-3-one?
The InChIKey is DPBKQJOOSMJCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NOS/c9-7-5-3-1-2-4-6(5)8-10-7/h1-4,8H.
What are the key properties of 1H-2,1-benzothiazol-3-one?
1H-2,1-benzothiazol-3-one has a molecular weight of 151.19 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-2,1-benzothiazol-3-one is sourced from PubChem (CID 734839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).