C14H13F4N3O3 — CID 7348475
(5S)-3-(4-fluorophenyl)-5-morpholin-4-yl-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 7348475) has the molecular formula C14H13F4N3O3 and a molecular weight of 347.27 g/mol. Its IUPAC name is (5S)-3-(4-fluorophenyl)-5-morpholin-4-yl-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-(4-fluorophenyl)-5-morpholin-4-yl-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7348475 |
| Molecular Formula | C14H13F4N3O3 |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (5S)-3-(4-fluorophenyl)-5-morpholin-4-yl-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@@](N2CCOCC2)(C(F)(F)F)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C14H13F4N3O3/c15-9-1-3-10(4-2-9)21-11(22)13(14(16,17)18,19-12(21)23)20-5-7-24-8-6-20/h1-4H,5-8H2,(H,19,23)/t13-/m0/s1 |
| InChIKey | YCKLEINGDYRZMN-ZDUSSCGKSA-N |
| XLogP | 1.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|