C20H20N4O3 — CID 73485056
1,3,8,8-tetramethyl-5-pyridin-4-yl-7,9-dihydropyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 73485056) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1,3,8,8-tetramethyl-5-pyridin-4-yl-7,9-dihydropyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 1,3,8,8-tetramethyl-5-pyridin-4-yl-7,9-dihydropyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 73485056 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1,3,8,8-tetramethyl-5-pyridin-4-yl-7,9-dihydropyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | Cn1c(=O)c2c(-c3ccncc3)c3c(nc2n(C)c1=O)CC(C)(C)CC3=O |
| InChI | InChI=1S/C20H20N4O3/c1-20(2)9-12-15(13(25)10-20)14(11-5-7-21-8-6-11)16-17(22-12)23(3)19(27)24(4)18(16)26/h5-8H,9-10H2,1-4H3 |
| InChIKey | ZVFRBAIYZXARLM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |