About (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine
(NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine (PubChem CID 7348692) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine |
| PubChem CID | 7348692 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine |
| SMILES | C=C(C)[C@H]1CC[C@@](C)(N2CCCCC2)/C(=N\O)C1 |
| InChI | InChI=1S/C15H26N2O/c1-12(2)13-7-8-15(3,14(11-13)16-18)17-9-5-4-6-10-17/h13,18H,1,4-11H2,2-3H3/b16-14-/t13-,15+/m0/s1 |
| InChIKey | WYPAETSPUQJPSF-QVJUESHNSA-N |
| XLogP | 3.44 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine (CID 7348692) is (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine is C=C(C)[C@H]1CC[C@@](C)(N2CCCCC2)/C(=N\O)C1.
What is the InChIKey of (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine?
The InChIKey is WYPAETSPUQJPSF-QVJUESHNSA-N. The full InChI is InChI=1S/C15H26N2O/c1-12(2)13-7-8-15(3,14(11-13)16-18)17-9-5-4-6-10-17/h13,18H,1,4-11H2,2-3H3/b16-14-/t13-,15+/m0/s1.
What are the key properties of (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine?
(NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine has a molecular weight of 250.39 g/mol, XLogP of 3.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[(2R,5S)-2-methyl-2-piperidin-1-yl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine is sourced from PubChem (CID 7348692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).