About [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium
[(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium (PubChem CID 7348730) has the molecular formula C12H23N2O+
and a molecular weight of 211.33 g/mol. Its IUPAC name is [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium.
Molecular Properties
| Compound Name | [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium |
| PubChem CID | 7348730 |
| Molecular Formula | C12H23N2O+ |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium |
| SMILES | C=C(C)[C@H]1CC[C@@](C)([NH+](C)C)/C(=N\O)C1 |
| InChI | InChI=1S/C12H22N2O/c1-9(2)10-6-7-12(3,14(4)5)11(8-10)13-15/h10,15H,1,6-8H2,2-5H3/p+1/b13-11-/t10-,12+/m0/s1 |
| InChIKey | HDYBOEKRMHUWEF-SXXPLBAKSA-O |
| XLogP | 1.10 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium?
The IUPAC name of [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium (CID 7348730) is [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium.
What is the SMILES notation for [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium?
The canonical SMILES for [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium is C=C(C)[C@H]1CC[C@@](C)([NH+](C)C)/C(=N\O)C1.
What is the InChIKey of [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium?
The InChIKey is HDYBOEKRMHUWEF-SXXPLBAKSA-O. The full InChI is InChI=1S/C12H22N2O/c1-9(2)10-6-7-12(3,14(4)5)11(8-10)13-15/h10,15H,1,6-8H2,2-5H3/p+1/b13-11-/t10-,12+/m0/s1.
What are the key properties of [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium?
[(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium has a molecular weight of 211.33 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2Z,4S)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]-dimethylazanium is sourced from PubChem (CID 7348730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).