C17H14NO4- — CID 7348792
3-[[(Z)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]amino]benzoate (PubChem CID 7348792) has the molecular formula C17H14NO4- and a molecular weight of 296.30 g/mol. Its IUPAC name is 3-[[(Z)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]amino]benzoate.
| Compound Name | 3-[[(Z)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 7348792 |
| Molecular Formula | C17H14NO4- |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-[[(Z)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]amino]benzoate |
| SMILES | COc1ccc(C(=O)/C=C\Nc2cccc(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-22-15-7-5-12(6-8-15)16(19)9-10-18-14-4-2-3-13(11-14)17(20)21/h2-11,18H,1H3,(H,20,21)/p-1/b10-9- |
| InChIKey | DDSFSUXALANNJO-KTKRTIGZSA-M |
| XLogP | 1.87 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|