C12H19N4O4+ — CID 7348880
5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7348880) has the molecular formula C12H19N4O4+ and a molecular weight of 283.31 g/mol. Its IUPAC name is 5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7348880 |
| Molecular Formula | C12H19N4O4+ |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(/C=N/CCC[NH+]2CCOCC2)C(=O)N1 |
| InChI | InChI=1S/C12H18N4O4/c17-10-9(11(18)15-12(19)14-10)8-13-2-1-3-16-4-6-20-7-5-16/h8-9H,1-7H2,(H2,14,15,17,18,19)/p+1/b13-8+ |
| InChIKey | GERBNNSMSQRXAE-MDWZMJQESA-O |
| XLogP | -2.66 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|