C6H10NO4- — CID 7349658
(2S,3R)-2-acetamido-3-hydroxybutanoate (PubChem CID 7349658) has the molecular formula C6H10NO4- and a molecular weight of 160.15 g/mol. Its IUPAC name is (2S,3R)-2-acetamido-3-hydroxybutanoate.
| Compound Name | (2S,3R)-2-acetamido-3-hydroxybutanoate |
|---|---|
| PubChem CID | 7349658 |
| Molecular Formula | C6H10NO4- |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (2S,3R)-2-acetamido-3-hydroxybutanoate |
| SMILES | CC(=O)N[C@H](C(=O)[O-])[C@@H](C)O |
| InChI | InChI=1S/C6H11NO4/c1-3(8)5(6(10)11)7-4(2)9/h3,5,8H,1-2H3,(H,7,9)(H,10,11)/p-1/t3-,5+/m1/s1 |
| InChIKey | PEDXUVCGOLSNLQ-WUJLRWPWSA-M |
| XLogP | -2.38 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |