C21H23FN2O5 — CID 7350574
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate (PubChem CID 7350574) has the molecular formula C21H23FN2O5 and a molecular weight of 402.42 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 7350574 |
| Molecular Formula | C21H23FN2O5 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
| SMILES | O=C(COC(=O)CCN1C(=O)[C@H]2CC=CC[C@@H]2C1=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN2O5/c22-15-7-5-14(6-8-15)9-11-23-18(25)13-29-19(26)10-12-24-20(27)16-3-1-2-4-17(16)21(24)28/h1-2,5-8,16-17H,3-4,9-13H2,(H,23,25)/t16-,17-/m0/s1 |
| InChIKey | GHSIIQYXUXRVJA-IRXDYDNUSA-N |
| XLogP | 1.37 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|