C23H29N3O4 — CID 7350841
(4S)-6-cyclohexyl-4-(2,5-dimethoxyphenyl)-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 7350841) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is (4S)-6-cyclohexyl-4-(2,5-dimethoxyphenyl)-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | (4S)-6-cyclohexyl-4-(2,5-dimethoxyphenyl)-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 7350841 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (4S)-6-cyclohexyl-4-(2,5-dimethoxyphenyl)-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | C=CCN1C(=O)N[C@@H](c2cc(OC)ccc2OC)C2=C1CN(C1CCCCC1)C2=O |
| InChI | InChI=1S/C23H29N3O4/c1-4-12-25-18-14-26(15-8-6-5-7-9-15)22(27)20(18)21(24-23(25)28)17-13-16(29-2)10-11-19(17)30-3/h4,10-11,13,15,21H,1,5-9,12,14H2,2-3H3,(H,24,28)/t21-/m0/s1 |
| InChIKey | ATWNMAVMGCSPFZ-NRFANRHFSA-N |
| XLogP | 3.39 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|