About (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine
(NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine (PubChem CID 7351141) has the molecular formula C14H21N2O+
and a molecular weight of 233.34 g/mol. Its IUPAC name is (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine |
| PubChem CID | 7351141 |
| Molecular Formula | C14H21N2O+ |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine |
| SMILES | C[C@@H]1C[NH+](Cc2ccccc2)[C@H](C)C/C1=N\O |
| InChI | InChI=1S/C14H20N2O/c1-11-9-16(12(2)8-14(11)15-17)10-13-6-4-3-5-7-13/h3-7,11-12,17H,8-10H2,1-2H3/p+1/b15-14+/t11-,12-/m1/s1 |
| InChIKey | VJXBICUWSHNVFV-GHMKZFAXSA-O |
| XLogP | 1.33 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine?
The IUPAC name of (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine (CID 7351141) is (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine is C[C@@H]1C[NH+](Cc2ccccc2)[C@H](C)C/C1=N\O.
What is the InChIKey of (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine?
The InChIKey is VJXBICUWSHNVFV-GHMKZFAXSA-O. The full InChI is InChI=1S/C14H20N2O/c1-11-9-16(12(2)8-14(11)15-17)10-13-6-4-3-5-7-13/h3-7,11-12,17H,8-10H2,1-2H3/p+1/b15-14+/t11-,12-/m1/s1.
What are the key properties of (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine?
(NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine has a molecular weight of 233.34 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[(2R,5R)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]hydroxylamine is sourced from PubChem (CID 7351141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).