C17H19Cl3N2O3 — CID 7351727
[(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4,5-trichloropyridine-2-carboxylate (PubChem CID 7351727) has the molecular formula C17H19Cl3N2O3 and a molecular weight of 405.71 g/mol. Its IUPAC name is [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4,5-trichloropyridine-2-carboxylate.
| Compound Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4,5-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7351727 |
| Molecular Formula | C17H19Cl3N2O3 |
| Molecular Weight | 405.71 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4,5-trichloropyridine-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ncc(Cl)c(Cl)c1Cl)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H19Cl3N2O3/c1-10(16(23)21-8-7-11-5-3-2-4-6-11)25-17(24)15-14(20)13(19)12(18)9-22-15/h5,9-10H,2-4,6-8H2,1H3,(H,21,23)/t10-/m0/s1 |
| InChIKey | WSEQNQCESDXTGA-JTQLQIEISA-N |
| XLogP | 4.59 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.71 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|