C22H24O3S — CID 7351974
[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate (PubChem CID 7351974) has the molecular formula C22H24O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7351974 |
| Molecular Formula | C22H24O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2c(s1)CCCCC2)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H24O3S/c23-19(17-11-10-15-6-4-5-7-16(15)12-17)14-25-22(24)21-13-18-8-2-1-3-9-20(18)26-21/h10-13H,1-9,14H2 |
| InChIKey | RTAHRUCKYBQGRT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |