About [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate (PubChem CID 7352545) has the molecular formula C19H19F2NO4S
and a molecular weight of 395.43 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate.
Molecular Properties
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate |
| PubChem CID | 7352545 |
| Molecular Formula | C19H19F2NO4S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate |
| SMILES | Cc1ccc(SCC(=O)OCC(=O)Nc2ccc(OC(F)F)cc2)cc1C |
| InChI | InChI=1S/C19H19F2NO4S/c1-12-3-8-16(9-13(12)2)27-11-18(24)25-10-17(23)22-14-4-6-15(7-5-14)26-19(20)21/h3-9,19H,10-11H2,1-2H3,(H,22,23) |
| InChIKey | AGBGTYDRJMNYEY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate?
The IUPAC name of [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate (CID 7352545) is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate.
What is the SMILES notation for [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate?
The canonical SMILES for [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate is Cc1ccc(SCC(=O)OCC(=O)Nc2ccc(OC(F)F)cc2)cc1C.
What is the InChIKey of [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate?
The InChIKey is AGBGTYDRJMNYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F2NO4S/c1-12-3-8-16(9-13(12)2)27-11-18(24)25-10-17(23)22-14-4-6-15(7-5-14)26-19(20)21/h3-9,19H,10-11H2,1-2H3,(H,22,23).
What are the key properties of [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate?
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate has a molecular weight of 395.43 g/mol, XLogP of 4.18, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3,4-dimethylphenyl)sulfanylacetate is sourced from PubChem (CID 7352545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).