About 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate
2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 735344) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 735344 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(N)sc1C(=O)OCC(C)C |
| InChI | InChI=1S/C9H14N2O2S/c1-5(2)4-13-8(12)7-6(3)11-9(10)14-7/h5H,4H2,1-3H3,(H2,10,11) |
| InChIKey | QAIORICWWKEVHM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate (CID 735344) is 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate is Cc1nc(N)sc1C(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is QAIORICWWKEVHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-5(2)4-13-8(12)7-6(3)11-9(10)14-7/h5H,4H2,1-3H3,(H2,10,11).
What are the key properties of 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate?
2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 214.29 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 735344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).