C15H17N3O2 — CID 7353494
(3aS,7aR)-3-(2,6-dimethylphenyl)-5,7-dimethyl-3a,7a-dihydro-[1,2]oxazolo[4,5-d]pyridazin-4-one (PubChem CID 7353494) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (3aS,7aR)-3-(2,6-dimethylphenyl)-5,7-dimethyl-3a,7a-dihydro-[1,2]oxazolo[4,5-d]pyridazin-4-one.
| Compound Name | (3aS,7aR)-3-(2,6-dimethylphenyl)-5,7-dimethyl-3a,7a-dihydro-[1,2]oxazolo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 7353494 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (3aS,7aR)-3-(2,6-dimethylphenyl)-5,7-dimethyl-3a,7a-dihydro-[1,2]oxazolo[4,5-d]pyridazin-4-one |
| SMILES | CC1=NN(C)C(=O)[C@H]2C(c3c(C)cccc3C)=NO[C@@H]12 |
| InChI | InChI=1S/C15H17N3O2/c1-8-6-5-7-9(2)11(8)13-12-14(20-17-13)10(3)16-18(4)15(12)19/h5-7,12,14H,1-4H3/t12-,14-/m0/s1 |
| InChIKey | XCFVUNVIAYIKRV-JSGCOSHPSA-N |
| XLogP | 1.87 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |