C16H15N4O5- — CID 7353542
4-[4-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]pyrazol-1-yl]butanoate (PubChem CID 7353542) has the molecular formula C16H15N4O5- and a molecular weight of 343.32 g/mol. Its IUPAC name is 4-[4-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]pyrazol-1-yl]butanoate.
| Compound Name | 4-[4-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]pyrazol-1-yl]butanoate |
|---|---|
| PubChem CID | 7353542 |
| Molecular Formula | C16H15N4O5- |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-[4-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]pyrazol-1-yl]butanoate |
| SMILES | O=C([O-])CCCn1cc(NC(=O)/C=C/c2cccc([N+](=O)[O-])c2)cn1 |
| InChI | InChI=1S/C16H16N4O5/c21-15(7-6-12-3-1-4-14(9-12)20(24)25)18-13-10-17-19(11-13)8-2-5-16(22)23/h1,3-4,6-7,9-11H,2,5,8H2,(H,18,21)(H,22,23)/p-1/b7-6+ |
| InChIKey | IOILEJMZAZIPHQ-VOTSOKGWSA-M |
| XLogP | 0.97 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|