About (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one
(3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one (PubChem CID 7353933) has the molecular formula C14H9Br2NO2
and a molecular weight of 383.04 g/mol. Its IUPAC name is (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one |
| PubChem CID | 7353933 |
| Molecular Formula | C14H9Br2NO2 |
| Molecular Weight | 383.04 g/mol |
| Exact Mass | 380.90 |
| IUPAC Name | (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(Br)cc2[C@@H]1c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H9Br2NO2/c15-7-1-3-11-9(5-7)13(14(19)17-11)10-6-8(16)2-4-12(10)18/h1-6,13,18H,(H,17,19)/t13-/m1/s1 |
| InChIKey | LQDZIHXXJZXSNI-CYBMUJFWSA-N |
| XLogP | 4.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.04 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one?
The IUPAC name of (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one (CID 7353933) is (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one.
What is the SMILES notation for (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one?
The canonical SMILES for (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one is O=C1Nc2ccc(Br)cc2[C@@H]1c1cc(Br)ccc1O.
What is the InChIKey of (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one?
The InChIKey is LQDZIHXXJZXSNI-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H9Br2NO2/c15-7-1-3-11-9(5-7)13(14(19)17-11)10-6-8(16)2-4-12(10)18/h1-6,13,18H,(H,17,19)/t13-/m1/s1.
What are the key properties of (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one?
(3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one has a molecular weight of 383.04 g/mol, XLogP of 4.00, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-bromo-3-(5-bromo-2-hydroxyphenyl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 7353933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).