C9H9F5NO+ — CID 7355967
3-(2,3,4,5,6-pentafluorophenoxy)propylazanium (PubChem CID 7355967) has the molecular formula C9H9F5NO+ and a molecular weight of 242.17 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenoxy)propylazanium.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenoxy)propylazanium |
|---|---|
| PubChem CID | 7355967 |
| Molecular Formula | C9H9F5NO+ |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenoxy)propylazanium |
| SMILES | [NH3+]CCCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H8F5NO/c10-4-5(11)7(13)9(8(14)6(4)12)16-3-1-2-15/h1-3,15H2/p+1 |
| InChIKey | SNRYOKUMUFGXPS-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|