About tert-butyl (2R)-2-aminopropanoate
tert-butyl (2R)-2-aminopropanoate (PubChem CID 7359212) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is tert-butyl (2R)-2-aminopropanoate.
Molecular Properties
| Compound Name | tert-butyl (2R)-2-aminopropanoate |
| PubChem CID | 7359212 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | tert-butyl (2R)-2-aminopropanoate |
| SMILES | C[C@@H](N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H15NO2/c1-5(8)6(9)10-7(2,3)4/h5H,8H2,1-4H3/t5-/m1/s1 |
| InChIKey | TZHVYFBSLOMRCU-RXMQYKEDSA-N |
| XLogP | 0.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (2R)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-2-aminopropanoate?
The IUPAC name of tert-butyl (2R)-2-aminopropanoate (CID 7359212) is tert-butyl (2R)-2-aminopropanoate.
What is the SMILES notation for tert-butyl (2R)-2-aminopropanoate?
The canonical SMILES for tert-butyl (2R)-2-aminopropanoate is C[C@@H](N)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R)-2-aminopropanoate?
The InChIKey is TZHVYFBSLOMRCU-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H15NO2/c1-5(8)6(9)10-7(2,3)4/h5H,8H2,1-4H3/t5-/m1/s1.
What are the key properties of tert-butyl (2R)-2-aminopropanoate?
tert-butyl (2R)-2-aminopropanoate has a molecular weight of 145.20 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-2-aminopropanoate is sourced from PubChem (CID 7359212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).