C12H13NO3 — CID 735929
(4S)-3-acetyl-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 735929) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (4S)-3-acetyl-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-acetyl-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 735929 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (4S)-3-acetyl-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | CC(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C12H13NO3/c1-9(14)13-11(8-16-12(13)15)7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3/t11-/m0/s1 |
| InChIKey | YMVGXIZVSPMNPD-NSHDSACASA-N |
| XLogP | 1.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |