About 2-amino-4,5-dimethoxybenzonitrile
2-amino-4,5-dimethoxybenzonitrile (PubChem CID 735967) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxybenzonitrile.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethoxybenzonitrile |
| PubChem CID | 735967 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-amino-4,5-dimethoxybenzonitrile |
| SMILES | COc1cc(N)c(C#N)cc1OC |
| InChI | InChI=1S/C9H10N2O2/c1-12-8-3-6(5-10)7(11)4-9(8)13-2/h3-4H,11H2,1-2H3 |
| InChIKey | BJAYMNUBIULRMF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-dimethoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethoxybenzonitrile?
The IUPAC name of 2-amino-4,5-dimethoxybenzonitrile (CID 735967) is 2-amino-4,5-dimethoxybenzonitrile.
What is the SMILES notation for 2-amino-4,5-dimethoxybenzonitrile?
The canonical SMILES for 2-amino-4,5-dimethoxybenzonitrile is COc1cc(N)c(C#N)cc1OC.
What is the InChIKey of 2-amino-4,5-dimethoxybenzonitrile?
The InChIKey is BJAYMNUBIULRMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-12-8-3-6(5-10)7(11)4-9(8)13-2/h3-4H,11H2,1-2H3.
What are the key properties of 2-amino-4,5-dimethoxybenzonitrile?
2-amino-4,5-dimethoxybenzonitrile has a molecular weight of 178.19 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethoxybenzonitrile is sourced from PubChem (CID 735967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).