About [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate
[(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate (PubChem CID 736048) has the molecular formula C22H20O3
and a molecular weight of 332.40 g/mol. Its IUPAC name is [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate.
Molecular Properties
| Compound Name | [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate |
| PubChem CID | 736048 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate |
| SMILES | CC(=O)O[C@@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20O3/c1-17(23)25-21(18-11-5-2-6-12-18)22(24,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21,24H,1H3/t21-/m0/s1 |
| InChIKey | GXLZCXZLVDUDHP-NRFANRHFSA-N |
| XLogP | 4.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate?
The IUPAC name of [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate (CID 736048) is [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate.
What is the SMILES notation for [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate?
The canonical SMILES for [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate is CC(=O)O[C@@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate?
The InChIKey is GXLZCXZLVDUDHP-NRFANRHFSA-N. The full InChI is InChI=1S/C22H20O3/c1-17(23)25-21(18-11-5-2-6-12-18)22(24,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21,24H,1H3/t21-/m0/s1.
What are the key properties of [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate?
[(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate has a molecular weight of 332.40 g/mol, XLogP of 4.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate is sourced from PubChem (CID 736048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).