About [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol
[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 736056) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 736056 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C)OC[C@@H](CO)O1 |
| InChI | InChI=1S/C6H12O3/c1-6(2)8-4-5(3-7)9-6/h5,7H,3-4H2,1-2H3/t5-/m1/s1 |
| InChIKey | RNVYQYLELCKWAN-RXMQYKEDSA-N |
| XLogP | 0.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (CID 736056) is [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol is CC1(C)OC[C@@H](CO)O1.
What is the InChIKey of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol?
The InChIKey is RNVYQYLELCKWAN-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H12O3/c1-6(2)8-4-5(3-7)9-6/h5,7H,3-4H2,1-2H3/t5-/m1/s1.
What are the key properties of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol?
[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol has a molecular weight of 132.16 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 736056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).