C22H29N5O4 — CID 7360655
(4S)-1-methyl-6-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-4-(3-nitrophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 7360655) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is (4S)-1-methyl-6-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-4-(3-nitrophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | (4S)-1-methyl-6-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-4-(3-nitrophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 7360655 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (4S)-1-methyl-6-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-4-(3-nitrophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | C[C@H]1CCCCN1CCCN1CC2=C(C1=O)[C@H](c1cccc([N+](=O)[O-])c1)NC(=O)N2C |
| InChI | InChI=1S/C22H29N5O4/c1-15-7-3-4-10-25(15)11-6-12-26-14-18-19(21(26)28)20(23-22(29)24(18)2)16-8-5-9-17(13-16)27(30)31/h5,8-9,13,15,20H,3-4,6-7,10-12,14H2,1-2H3,(H,23,29)/t15-,20-/m0/s1 |
| InChIKey | PFVNYMOHHUEVLD-YWZLYKJASA-N |
| XLogP | 2.65 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|