About (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine
(2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine (PubChem CID 736167) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine |
| PubChem CID | 736167 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine |
| SMILES | CC[C@H]1CO[C@@](C)(CCC(C)C)N1 |
| InChI | InChI=1S/C11H23NO/c1-5-10-8-13-11(4,12-10)7-6-9(2)3/h9-10,12H,5-8H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | QJMLZAWFWIPNOD-QWRGUYRKSA-N |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine?
The IUPAC name of (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine (CID 736167) is (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine.
What is the SMILES notation for (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine?
The canonical SMILES for (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine is CC[C@H]1CO[C@@](C)(CCC(C)C)N1.
What is the InChIKey of (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine?
The InChIKey is QJMLZAWFWIPNOD-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H23NO/c1-5-10-8-13-11(4,12-10)7-6-9(2)3/h9-10,12H,5-8H2,1-4H3/t10-,11-/m0/s1.
What are the key properties of (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine?
(2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine has a molecular weight of 185.31 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-4-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine is sourced from PubChem (CID 736167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).